CAS 73816-58-7
:6-nitro-2,3-dihydro-1H-indole-1-carbaldehyde
Description:
6-Nitro-2,3-dihydro-1H-indole-1-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a nitro group at the 6-position and an aldehyde functional group at the 1-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents. Its nitro group can participate in various chemical reactions, making it a useful intermediate in the synthesis of more complex molecules. The aldehyde functionality allows for further derivatization, enabling the formation of various derivatives through reactions such as condensation or reduction. Due to its structural features, 6-nitro-2,3-dihydro-1H-indole-1-carbaldehyde may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H8N2O3
InChI:InChI=1/C9H8N2O3/c12-6-10-4-3-7-1-2-8(11(13)14)5-9(7)10/h1-2,5-6H,3-4H2
SMILES:c1cc(cc2c1CCN2C=O)N(=O)=O
Synonyms:- 1H-indole-1-carboxaldehyde, 2,3-dihydro-6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.