CAS 7382-41-4
:2-(4-chlorophenyl)hydrazinecarbothioamide
Description:
2-(4-Chlorophenyl)hydrazinecarbothioamide, with the CAS number 7382-41-4, is an organic compound characterized by the presence of a hydrazine functional group and a thiocarbonyl moiety. This compound features a 4-chlorophenyl group, which contributes to its aromatic properties and potential reactivity. The presence of the thiocarbonamide functional group suggests that it may exhibit properties typical of thioamides, such as potential nucleophilicity and the ability to participate in various chemical reactions, including condensation and substitution reactions. The chlorophenyl substituent can influence the compound's solubility, stability, and reactivity, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry. Additionally, compounds of this nature may exhibit biological activity, which warrants further investigation for applications in pharmaceuticals or agrochemicals. Safety data should be consulted, as compounds containing halogens and nitrogen functionalities can pose health risks and require appropriate handling and disposal measures.
Formula:C7H8ClN3S
InChI:InChI=1/C7H8ClN3S/c8-5-1-3-6(4-2-5)10-11-7(9)12/h1-4,10H,(H3,9,11,12)
InChI key:InChIKey=XJVVZHDEYSKSHF-UHFFFAOYSA-N
SMILES:N(NC(N)=S)C1=CC=C(Cl)C=C1
Synonyms:- 1-(4-Chloro-phenyl)-thiosemicarbazide
- 4-Chlorophenylthiosemicarbazide
- Hydrazinecarbothioamide, 2-(4-Chlorophenyl)-
- NSC 379291
- Semicarbazide, 1-(p-chlorophenyl)-3-thio-
- [(4-Chlorophenyl)amino]thiourea
- 2-(4-Chlorophenyl)hydrazinecarbothioamide
- 2-(4-Chlorophenyl)hydrazine-1-carbothioamide
- 2-(4-CHLOROPHENYL)-1-HYDRAZINECARBOTHIOAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
