CymitQuimica logo

CAS 7382-52-7

:

2-O-(4-O-Methyl-α-D-glucopyranuronosyl)-D-xylose

Description:
2-O-(4-O-Methyl-α-D-glucopyranuronosyl)-D-xylose, with the CAS number 7382-52-7, is a glycoside that features a D-xylose sugar moiety linked to a 4-O-methyl-α-D-glucopyranuronosyl group. This compound is characterized by its structural complexity, which includes multiple hydroxyl groups that contribute to its solubility in water and potential reactivity. The presence of the methyl ether group enhances its stability and may influence its biological activity. Glycosides like this one often exhibit various properties, including sweetness, and can participate in biochemical processes such as cell signaling or serve as precursors in the synthesis of more complex carbohydrates. The specific stereochemistry of the sugar units plays a crucial role in determining the compound's interactions with enzymes and receptors. Overall, this compound is of interest in fields such as biochemistry and pharmacology, where understanding its properties can lead to insights into its potential applications in medicine or nutrition.
Formula:C12H20O11
InChI:InChI=1S/C12H20O11/c1-21-9-7(17)8(18)12(23-10(9)11(19)20)22-5(3-14)6(16)4(15)2-13/h3-10,12-13,15-18H,2H2,1H3,(H,19,20)/t4-,5+,6+,7-,8-,9+,10+,12+/m1/s1
InChI key:InChIKey=ZDDGWONHTPYERI-MOEYFMCOSA-N
SMILES:O(C)[C@@H]1[C@@H](C(O)=O)O[C@H](O[C@H]([C@H]([C@@H](CO)O)O)C=O)[C@H](O)[C@H]1O
Synonyms:
  • 2-O-(4-O-Methyl-α-D-glucopyranuronosyl)-D-xylose
  • Xylose, 2-O-(4-O-methyl-α-D-glucopyranuronosyl)-, D-
  • D-Xylose, 2-O-(4-O-methyl-α-D-glucopyranuronosyl)-
  • Xylose, 2-O-(4-O-methyl-α-D-glucuronosyl)-
  • 2-O-(4-O-Methyl-α-D-glucopyranosyluronic acid)-D-xylose
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.