![1-[2-(3-methoxyphenyl)cyclohex-1-en-1-yl]-N,N-dimethylmethanamine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F47525-1-2-3-methoxyphenyl-cyclohex-1-en-1-yl-n-n-dimethylmethanamine.webp&w=3840&q=75)
CAS 73825-64-6
:1-[2-(3-methoxyphenyl)cyclohex-1-en-1-yl]-N,N-dimethylmethanamine
Description:
1-[2-(3-Methoxyphenyl)cyclohex-1-en-1-yl]-N,N-dimethylmethanamine, with the CAS number 73825-64-6, is a chemical compound characterized by its complex structure that includes a cyclohexene ring and a methoxyphenyl group. This compound features a dimethylamino group, which contributes to its basicity and potential for forming salts with acids. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility in organic solvents. The cyclohexene moiety introduces a degree of unsaturation, which may affect its reactivity and stability under various conditions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential interactions with biological targets, although specific biological properties would require empirical investigation. Overall, the compound's unique arrangement of functional groups and rings contributes to its chemical behavior and potential applications in medicinal chemistry or related fields.
Formula:C16H23NO
InChI:InChI=1/C16H23NO/c1-17(2)12-14-7-4-5-10-16(14)13-8-6-9-15(11-13)18-3/h6,8-9,11H,4-5,7,10,12H2,1-3H3
SMILES:CN(C)CC1=C(CCCC1)c1cccc(c1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
