CymitQuimica logo

CAS 73829-38-6

:

1,5-dimethyl-4-[methyl(nitroso)amino]-2-phenyl-1,2-dihydro-3H-pyrazol-3-one

Description:
1,5-Dimethyl-4-[methyl(nitroso)amino]-2-phenyl-1,2-dihydro-3H-pyrazol-3-one is a chemical compound characterized by its complex structure, which includes a pyrazolone core substituted with various functional groups. The presence of both methyl and nitroso groups indicates potential reactivity, particularly in biological systems, where nitroso compounds can participate in various chemical reactions, including nitrosation. This compound may exhibit properties typical of pyrazolones, such as potential anti-inflammatory or analgesic effects, although specific biological activities would depend on its precise interactions within a biological context. The phenyl group contributes to its hydrophobic character, which may influence its solubility and bioavailability. Additionally, the compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of new pharmaceuticals. However, safety and toxicity profiles would need to be thoroughly evaluated before any practical applications. Overall, this compound represents a unique combination of structural features that could lead to interesting chemical and biological properties.
Formula:C12H14N4O2
InChI:InChI=1/C12H14N4O2/c1-9-11(14(2)13-18)12(17)16(15(9)3)10-7-5-4-6-8-10/h4-8H,1-3H3
SMILES:Cc1c(c(=O)n(c2ccccc2)n1C)N(C)N=O
Synonyms:
  • 3H-pyrazol-3-one, 1,2-dihydro-1,5-dimethyl-4-(methylnitrosoamino)-2-phenyl-
  • 1,5-Dimethyl-4-[methyl(nitroso)amino]-2-phenyl-1,2-dihydro-3H-pyrazol-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.