CAS 7383-14-4
:(4-sulfamoylphenoxy)acetic acid
Description:
(4-Sulfamoylphenoxy)acetic acid, with the CAS number 7383-14-4, is a chemical compound characterized by its sulfonamide functional group and phenoxyacetic acid structure. This compound typically appears as a white to off-white solid and is soluble in water, which is a notable feature for many sulfonamide derivatives. It possesses both acidic and basic properties due to the carboxylic acid and sulfonamide groups, allowing it to participate in various chemical reactions. The presence of the sulfonamide group contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests it may interact with biological systems, potentially influencing enzyme activity or serving as a scaffold for drug design. Additionally, the compound's stability and reactivity can be influenced by pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, (4-sulfamoylphenoxy)acetic acid is a versatile compound with significant implications in both chemistry and pharmacology.
Formula:C8H9NO5S
InChI:InChI=1/C8H9NO5S/c9-15(12,13)7-3-1-6(2-4-7)14-5-8(10)11/h1-4H,5H2,(H,10,11)(H2,9,12,13)
InChI key:InChIKey=IIILLPUTZFBNTB-UHFFFAOYSA-N
SMILES:c1cc(ccc1OCC(=O)O)S(=O)(=O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(4-Sulfamoylphenoxy)acetic acid
CAS:2-(4-Sulfamoylphenoxy)acetic acid is a chemical compound with the formula CHOSO2H. It is a colorless liquid that is soluble in water and polar organic solvents. It can be prepared by treating 4-hydroxybenzoic acid with sulfuryl chloride to produce the ethyl ester, which hydrolyses to give 2-(4-sulfamoylphenoxy)acetic acid. The compound has been used as a model for kinetic studies of reactions involving protonated amines and hydroxyl groups. A microencapsulation technique was developed for preparing stable dispersions of the drug in water with an average particle size of 1.5 micrometres.Formula:C8H9NO5SPurity:Min. 95%Molecular weight:231.23 g/mol

