CAS 7383-30-4
:O,alpha-dimethyltyrosine
Description:
O,alpha-dimethyltyrosine, also known as 3,4-dimethyl-L-tyrosine, is an amino acid derivative characterized by the presence of two methyl groups attached to the aromatic ring of the tyrosine structure. This compound is notable for its role in biochemical research, particularly in studies related to protein synthesis and enzyme activity. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. O,alpha-dimethyltyrosine can influence the activity of certain enzymes and receptors due to its structural similarity to tyrosine, which is a precursor for neurotransmitters and hormones. The compound is typically used in laboratory settings for various applications, including the synthesis of peptides and as a research tool in neurobiology. Its solubility in water and organic solvents varies, and it is generally stable under standard laboratory conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H15NO3
InChI:InChI=1/C11H15NO3/c1-11(12,10(13)14)7-8-3-5-9(15-2)6-4-8/h3-6H,7,12H2,1-2H3,(H,13,14)
SMILES:CC(Cc1ccc(cc1)OC)(C(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
O,α-Dimethyl-DL-tyrosine
CAS:Controlled ProductFormula:C11H15NO3Color and Shape:NeatMolecular weight:209.24


