CAS 7383-63-3
:Mercaptoacetic acid benzyl ester
Description:
Mercaptoacetic acid benzyl ester, with the CAS number 7383-63-3, is an organic compound characterized by the presence of both a thiol (mercapto) group and an ester functional group. This compound typically appears as a colorless to pale yellow liquid with a distinct odor. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic benzyl group. The presence of the thiol group imparts unique reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and the formation of disulfides. Additionally, the ester functionality can undergo hydrolysis, making it susceptible to reactions with nucleophiles. Mercaptoacetic acid benzyl ester is often utilized in organic synthesis and may serve as a building block in the preparation of more complex molecules, particularly in the fields of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as thiols can be malodorous and may pose health risks upon exposure.
Formula:C9H10O2S
InChI:InChI=1/C9H10O2S/c10-9(7-12)11-6-8-4-2-1-3-5-8/h1-5,12H,6-7H2
SMILES:c1ccc(cc1)COC(=O)CS
Synonyms:- Acetic Acid, 2-Mercapto-, Phenylmethyl Ester
- Acetic acid, mercapto-, benzyl ester
- Acetic acid, mercapto-, phenylmethyl ester
- Benzyl sulfanylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Benzyl 2-sulfanylacetate
CAS:Benzyl 2-sulfanylacetate is a liquid crystal compound that belongs to the group of aromatic hydrocarbons and fatty acids. It has a high resistance to chloride and an alkylthio group. Benzyl 2-sulfanylacetate can be used as a film-forming polymer, which is used in the stabilizing of pyrimidine compounds and phosphites. Benzyl 2-sulfanylacetate also has neurotrophic effects and can be used for dry extract enzymatic reactions.Formula:C9H10O2SPurity:Min. 95%Molecular weight:182.24 g/mol
