CAS 7383-77-9
:1-Dimethylamino-2-pentyne
Description:
1-Dimethylamino-2-pentyne is an organic compound characterized by its alkyne functional group and the presence of a dimethylamino substituent. It features a linear carbon chain with a total of five carbon atoms, making it a member of the alkyne family, which is known for having a carbon-carbon triple bond. The dimethylamino group, which consists of a nitrogen atom bonded to two methyl groups, imparts basic properties to the molecule, allowing it to act as a nucleophile in various chemical reactions. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic carbon chain. 1-Dimethylamino-2-pentyne is used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. As with many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use.
Formula:C7H13N
InChI:InChI=1/C7H13N/c1-4-5-6-7-8(2)3/h4,7H2,1-3H3
SMILES:CCC#CCN(C)C
Synonyms:- N,N-dimethylpent-2-yn-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
