CAS 73831-13-7

4-cyano-3-methylbenzoic acid

Description:

4-Cyano-3-methylbenzoic acid is an aromatic compound characterized by the presence of both a cyano group (-CN) and a carboxylic acid group (-COOH) attached to a methyl-substituted benzene ring. The cyano group is located at the para position relative to the carboxylic acid, while the methyl group is situated at the meta position. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the cyano group enhances its reactivity, making it useful in synthetic organic chemistry, particularly in the preparation of other functionalized compounds. Additionally, 4-cyano-3-methylbenzoic acid can serve as a building block in the synthesis of pharmaceuticals and agrochemicals. Its unique structure contributes to its potential applications in materials science, particularly in the development of liquid crystals and polymers.

Formula: C₉H₇NO₂

InChI: InChI=1/C9H7NO2/c1-6-4-7(9(11)12)2-3-8(6)5-10/h2-4H,1H3,(H,11,12)

SMILES: Cc1cc(ccc1C#N)C(=O)O

4-Cyano-3-methylbenzoic acid

CAS: 73831-13-7

Formula: C₉H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.1574

Ref: IN-DA003L8U

4-Cyano-3-methylbenzoic acid

CAS: 73831-13-7

4-Cyano-3-methylbenzoic acid

Formula: C₉H₇NO₂

Purity: 98%

Color and Shape: solid

Molecular weight: 161.16g/mol

Ref: 54-OR301015

4-Cyano-3-methylbenzoic acid

CAS: 73831-13-7

4-Cyano-3-methylbenzoic acid is a ligand that can be used to detect lanthanide ions. It has been shown to have a high sensitivity and low detection limit for lanthanides such as europium, terbium, and dysprosium. 4-Cyano-3-methylbenzoic acid emits red light when it is in the presence of oxygen atoms, which can be used to measure oxygen levels in the atmosphere. 4-Cyano-3-methylbenzoic acid also has luminescent properties that are dependent on its coordination number and wavelength. The emission wavelengths of this ligand range from 380 nm (lowest) to 640 nm (highest).

Formula: C₉H₇NO₂

Purity: Min. 95%

Molecular weight: 161.16 g/mol

Ref: 3D-FC33067

4-Cyano-3-methylbenzoic acid

CAS: 73831-13-7

Formula: C₉H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.16

Ref: 10-F079234