CAS 73839-20-0
:tert-butyl 6-hydroxyhexanoate
Description:
Tert-butyl 6-hydroxyhexanoate is an ester compound characterized by its structure, which includes a tert-butyl group and a hexanoate moiety with a hydroxyl functional group at the sixth carbon position. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility and moderate solubility in organic solvents. It exhibits properties common to esters, such as pleasant, fruity odors, making it potentially useful in flavor and fragrance applications. The presence of the hydroxyl group contributes to its reactivity, allowing for potential hydrogen bonding and influencing its physical properties, such as boiling point and solubility. Tert-butyl 6-hydroxyhexanoate may also participate in various chemical reactions, including esterification and transesterification, which are relevant in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential irritant properties.
Formula:C10H20O3
InChI:InChI=1/C10H20O3/c1-10(2,3)13-9(12)7-5-4-6-8-11/h11H,4-8H2,1-3H3
SMILES:CC(C)(C)OC(=O)CCCCCO
Synonyms:- Hexanoic acid,6-hydroxy-, 1,1-dimethylethyl ester
- tert -Butyl 6-Hydroxyhexanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Hexanoic acid,6-hydroxy-, 1,1-dimethylethyl ester
CAS:Formula:C10H20O3Purity:95%Color and Shape:LiquidMolecular weight:188.2640Ref: IN-DA005KBG
1g64.00€5g197.00€10g281.00€15g542.00€25g683.00€50gTo inquire100gTo inquire100mg28.00€250mg31.00€Tert-butyl 6-hydroxyhexanoate
CAS:Tert-butyl 6-hydroxyhexanoate (BHH) is an initiator for the preparation of 伪-tert-butyloxycarbonyl蠅-hydroxyheterobifunctional poly-PCL and poly-PVL.Formula:C10H20O3Purity:≥98%Color and Shape:SolidMolecular weight:188.26Tert-butyl 6-hydroxyhexanoate
CAS:Tert-butyl 6-hydroxyhexanoatePurity:≥98%Molecular weight:188.26g/moltert-Butyl 6-Hydroxyhexanoate
CAS:Controlled ProductApplications tert-Butyl 6-Hydroxyhexanoate is an aliphatic tert-butyl ester with a terminal hydroxyl
Formula:C10H20O3Color and Shape:NeatMolecular weight:188.26




