CAS 73839-23-3

3,5,12-Trioxa-4-phosphatetradecan-1-aminium, 4-hydroxy-N,N,N,13,13-pentamethyl-11-oxo-, inner salt, 4-oxide

Description:

3,5,12-Trioxa-4-phosphatetradecan-1-aminium, 4-hydroxy-N,N,N,13,13-pentamethyl-11-oxo-, inner salt, 4-oxide, identified by CAS number 73839-23-3, is a complex organic compound featuring multiple functional groups, including phosphonium, hydroxyl, and oxo groups. This substance is characterized by its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic environments, making it potentially useful in various applications such as surfactants, emulsifiers, or drug delivery systems. The presence of the phosphonium ion suggests that it may exhibit cationic properties, which can enhance its solubility in aqueous solutions. Additionally, the multiple oxygen-containing groups contribute to its reactivity and potential for forming hydrogen bonds. The structural complexity and functional diversity of this compound may also impart unique biological activities, warranting further investigation into its potential uses in pharmaceuticals or materials science. Overall, its distinctive chemical structure and properties make it a subject of interest in both academic and industrial research.

Formula: C₁₅H₃₂NO₆P

InChI: InChI=1S/C15H32NO6P/c1-15(2,3)22-14(17)10-8-7-9-12-20-23(18,19)21-13-11-16(4,5)6/h7-13H2,1-6H3

InChI key: InChIKey=JNJAYILGKOYKRR-UHFFFAOYSA-N

SMILES: P(OCC[N+](C)(C)C)(OCCCCCC(OC(C)(C)C)=O)(=O)[O-]

Synonyms:

• 3,5,12-Trioxa-4-phosphatetradecan-1-aminium, 4-hydroxy-N,N,N,13,13-pentamethyl-11-oxo-, inner salt, 4-oxide