CAS 73839-70-0
:N-ethyl-1-(furan-2-yl)-2-phenylethanamine
Description:
N-ethyl-1-(furan-2-yl)-2-phenylethanamine, with the CAS number 73839-70-0, is an organic compound characterized by its unique structure that includes an ethyl group, a furan ring, and a phenylethanamine moiety. This compound is classified as an amine due to the presence of the amine functional group (-NH) attached to a carbon chain. The furan ring contributes to its aromatic properties, while the phenyl group enhances its hydrophobic characteristics. Typically, compounds of this nature may exhibit biological activity, potentially interacting with neurotransmitter systems, which makes them of interest in pharmacological research. The presence of both furan and phenyl groups suggests that it may have interesting electronic properties and could participate in various chemical reactions, including electrophilic substitutions. Additionally, its solubility and stability can be influenced by the substituents on the aromatic rings and the overall molecular structure. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H17NO
InChI:InChI=1/C14H17NO/c1-2-15-13(14-9-6-10-16-14)11-12-7-4-3-5-8-12/h3-10,13,15H,2,11H2,1H3
SMILES:CCNC(Cc1ccccc1)c1ccco1
Synonyms:- 2-Furanmethanamine, N-ethyl-.alpha.- (phenylmethyl)-
- Furfurylamine, .alpha.-benzyl-N-ethyl-
- N-(.alpha.-Benzylfurfuryl)ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.