CAS 73839-94-8

4-[3-(trifluoromethyl)phenyl]butan-2-amine

Description:

4-[3-(Trifluoromethyl)phenyl]butan-2-amine, with the CAS number 73839-94-8, is an organic compound characterized by its amine functional group and a butane backbone. This compound features a trifluoromethyl group attached to a phenyl ring, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the trifluoromethyl group often enhances the compound's stability and alters its reactivity compared to similar compounds without this substituent. As an amine, it can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can lead to enhanced efficacy or selectivity. Additionally, the presence of fluorine atoms can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with fluorinated compounds.

Formula: C₁₁H₁₄F₃N

InChI: InChI=1/C11H14F3N/c1-8(15)5-6-9-3-2-4-10(7-9)11(12,13)14/h2-4,7-8H,5-6,15H2,1H3

SMILES: CC(CCc1cccc(c1)C(F)(F)F)N