CAS 73844-29-8

2-(pentylsulfanyl)-1,3-benzothiazol-6-amine

Description:

2-(Pentylsulfanyl)-1,3-benzothiazol-6-amine is an organic compound characterized by its unique structure, which includes a benzothiazole moiety and a pentylsulfanyl group. The presence of the benzothiazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The amine functional group enhances its reactivity and solubility in polar solvents, making it suitable for various chemical reactions. The pentylsulfanyl substituent introduces hydrophobic characteristics, which can influence the compound's interaction with biological membranes and its overall bioavailability. This compound may exhibit properties such as antimicrobial or anticancer activity, typical of many benzothiazole derivatives. Additionally, its molecular structure suggests potential applications in medicinal chemistry, materials science, or as a building block in organic synthesis. However, specific data regarding its toxicity, stability, and detailed biological effects would require further investigation and experimental validation.

Formula: C₁₂H₁₆N₂S₂

InChI: InChI=1/C12H16N2S2/c1-2-3-4-7-15-12-14-10-6-5-9(13)8-11(10)16-12/h5-6,8H,2-4,7,13H2,1H3

SMILES: CCCCCSc1nc2ccc(cc2s1)N

Synonyms:

• 2-(Pentylthio)-6-benzothiazolamine
• 6-Benzothiazolamine, 2-(Pentylthio)-