CymitQuimica logo

CAS 73855-45-5

:

6-chloro-1,2,3,4-tetrahydroquinoxaline

Description:
6-Chloro-1,2,3,4-tetrahydroquinoxaline is a heterocyclic organic compound characterized by its bicyclic structure, which includes a quinoxaline framework with a chlorine substituent at the 6-position. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents. Its molecular structure features a saturated tetrahydroquinoxaline ring, which contributes to its unique chemical reactivity and potential biological activity. The presence of the chlorine atom can influence its electronic properties and reactivity, making it a subject of interest in medicinal chemistry and drug development. 6-Chloro-1,2,3,4-tetrahydroquinoxaline may exhibit various pharmacological activities, including potential neuroprotective or anti-inflammatory effects, although specific biological data may vary. As with many heterocycles, it can participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, making it a versatile building block in organic synthesis. Proper handling and safety measures should be observed due to its chemical nature and potential biological effects.
Formula:C8H9ClN2
InChI:InChI=1/C8H9ClN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5,10-11H,3-4H2
SMILES:c1cc2c(cc1Cl)NCCN2
Synonyms:
  • 6-Chlor-1,2,3,4-tetrahydrochinoxalin
  • Quinoxaline, 6-Chloro-1,2,3,4-Tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.