CAS 73855-46-6

1-Ethyl-1,2,3,4-tetrahydroquinoxaline

Description:

1-Ethyl-1,2,3,4-tetrahydroquinoxaline is a bicyclic organic compound characterized by its unique structure, which consists of a quinoxaline core with an ethyl substituent. This compound features a saturated tetrahydroquinoxaline ring, making it a member of the tetrahydroquinoxaline family. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of nitrogen atoms in its structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit various properties such as solubility in organic solvents and moderate stability under standard conditions. Its reactivity can be influenced by the presence of functional groups and the overall electronic environment of the molecule. As with many nitrogen-containing heterocycles, 1-ethyl-1,2,3,4-tetrahydroquinoxaline may participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₀H₁₄N₂

InChI: InChI=1/C10H14N2/c1-2-12-8-7-11-9-5-3-4-6-10(9)12/h3-6,11H,2,7-8H2,1H3

InChI key: InChIKey=KIDFEKJWQHWALS-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(NCC1)=CC=CC2

Synonyms:

• Quinoxaline, 1-ethyl-1,2,3,4-tetrahydro-
• 1-Ethyl-1,2,3,4-tetrahydroquinoxaline

1-Ethyl-1,2,3,4-tetrahydroquinoxaline

CAS: 73855-46-6

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂

Purity: Min. 95%

Molecular weight: 162.23 g/mol

Ref: 3D-YCA85546