CAS 73855-54-6

N-(4-oxo-2-thioxo-1,3-thiazolidin-3-yl)acetamide hydrate

Description:

N-(4-oxo-2-thioxo-1,3-thiazolidin-3-yl)acetamide hydrate, with the CAS number 73855-54-6, is a chemical compound that features a thiazolidine ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound typically exhibits properties associated with thiazolidine derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the acetamide group suggests it may participate in hydrogen bonding, enhancing its solubility in polar solvents. As a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and reactivity. The thioxo group contributes to its reactivity, potentially allowing for nucleophilic attack or participation in redox reactions. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and material science, although specific applications would depend on further research into its biological and chemical properties.

Formula: C₅H₈N₂O₃S₂

InChI: InChI=1/C5H6N2O2S2.H2O/c1-3(8)6-7-4(9)2-11-5(7)10;/h2H2,1H3,(H,6,8);1H2

SMILES: CC(=NN1C(=O)CSC1=S)O.O

N-Acetamidorhodanine monohydrate

CAS: 73855-54-6

N-Acetamidorhodanine monohydrate is a reagent that has been used as a precursor to the compound N,N'-diacetyl-N,N'-bis(2-hydroxybenzyl)rhodanine. This chemical is a useful intermediate for the production of fine chemicals, such as agricultural and pharmaceuticals. It is also a versatile building block for organic synthesis and can be used as a reaction component in the production of other compounds.

Formula: C₅H₆N₂O₂S₂•H₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 208.26 g/mol

Ref: 3D-FA67587