CymitQuimica logo

CAS 73855-64-8

:

5-(1,3-benzodioxol-5-ylmethylidene)-2-(hydroxyamino)-1,3-thiazol-4(5H)-one

Description:
5-(1,3-benzodioxol-5-ylmethylidene)-2-(hydroxyamino)-1,3-thiazol-4(5H)-one, with the CAS number 73855-64-8, is a chemical compound characterized by its complex structure that includes a thiazole ring, a hydroxyamino group, and a benzodioxole moiety. This compound typically exhibits properties associated with both thiazole derivatives and aromatic compounds, which may include moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The hydroxyamino group can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the benzodioxole structure may contribute to its biological activity, as compounds containing this moiety are often investigated for pharmacological properties. The thiazole ring is known for its role in various biological activities, including antimicrobial and anticancer effects. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry and materials science, although specific biological or chemical activities would require further investigation through empirical studies.
Formula:C11H8N2O4S
InChI:InChI=1/C11H8N2O4S/c14-10-9(18-11(12-10)13-15)4-6-1-2-7-8(3-6)17-5-16-7/h1-4,15H,5H2,(H,12,13,14)
Synonyms:
  • 4(5H)-Thiazolone, 5-(1,3-benzodioxol-5-ylmethylene)-2-(hydroxyamino)-
  • 5-[(E)-1,3-BENZODIOXOL-5-YLMETHYLIDENE]-2-(HYDROXYAMINO)-1,3-THIAZOL-4(5H)-ONE
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.