CAS 738580-34-2

chloro-[[4-(trifluoromethyl)phenyl]methyl]zinc

Description:

Chloro-[[4-(trifluoromethyl)phenyl]methyl]zinc, with the CAS number 738580-34-2, is an organozinc compound characterized by the presence of a zinc atom coordinated to a chloro group and a phenyl group substituted with a trifluoromethyl group. This compound typically exhibits a white to light yellow solid appearance and is known for its reactivity, particularly in organic synthesis. The trifluoromethyl group enhances the electron-withdrawing properties of the phenyl ring, which can influence the compound's reactivity and stability. Organozinc compounds like this one are often utilized as reagents in cross-coupling reactions, such as the Suzuki or Negishi reactions, due to their ability to form carbon-carbon bonds. Additionally, the presence of the chlorine atom can facilitate further functionalization or transformation in synthetic pathways. Safety precautions should be observed when handling this compound, as organozinc reagents can be sensitive to moisture and air, potentially leading to hazardous reactions.

Formula: C₈H₆ClF₃Zn

InChI: InChI=1/C8H6F3.ClH.Zn/c1-6-2-4-7(5-3-6)8(9,10)11;;/h2-5H,1H2;1H;/q;;+1/p-1/rC8H6ClF3Zn/c9-13-5-6-1-3-7(4-2-6)8(10,11)12/h1-4H,5H2

SMILES: C=C1C=CC(C=C1)C(F)(F)F.Cl.[Zn]