CAS 738580-35-3

[1,1′-Biphenyl]-2-yliodozinc

Description:

[1,1′-Biphenyl]-2-yliodozinc, with the CAS number 738580-35-3, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo-substituted biphenyl moiety. This compound typically exhibits properties associated with organometallic substances, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in cross-coupling reactions. The presence of the iodo group enhances its reactivity, allowing it to participate in transformations that involve the formation of carbon-carbon bonds. Additionally, organozinc compounds are generally stable under anhydrous conditions but can be sensitive to moisture and air, necessitating careful handling and storage. The compound's structure allows for potential applications in organic synthesis, including the preparation of complex organic molecules and pharmaceuticals. Overall, [1,1′-Biphenyl]-2-yliodozinc serves as a valuable reagent in modern organic chemistry, particularly in the field of synthetic methodology.

Formula: C₁₂H₉IZn

InChI: InChI=1S/C12H9.HI.Zn/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h1-9H;1H;/q;;+1/p-1

InChI key: InChIKey=NZDOSHJYDSGZHH-UHFFFAOYSA-M

SMILES: [Zn](I)C1=C(C=CC=C1)C2=CC=CC=C2

Synonyms:

• [1,1′-Biphenyl]-2-yliodozinc
• Zinc, [1,1′-biphenyl]-2-yliodo-