CymitQuimica logo

CAS 738580-37-5

:

(2,5-dimethoxyphenyl)-iodo-zinc

Description:
(2,5-Dimethoxyphenyl)-iodo-zinc, identified by its CAS number 738580-37-5, is an organozinc compound that features a zinc atom bonded to an iodo group and a 2,5-dimethoxyphenyl moiety. This compound typically exhibits characteristics common to organozinc reagents, such as high reactivity and the ability to participate in various organic transformations, including cross-coupling reactions. The presence of the iodo group enhances its electrophilic nature, making it useful in synthetic chemistry for the introduction of the 2,5-dimethoxyphenyl group into other organic molecules. The dimethoxy substituents on the phenyl ring can influence the electronic properties of the compound, potentially enhancing its reactivity and solubility in organic solvents. Additionally, the compound may be sensitive to moisture and air, necessitating careful handling and storage under inert conditions. Overall, (2,5-dimethoxyphenyl)-iodo-zinc serves as a valuable intermediate in the synthesis of complex organic compounds, particularly in the field of medicinal chemistry and materials science.
Formula:C8H9IO2Zn
InChI:InChI=1/C8H9O2.HI.Zn/c1-9-7-3-5-8(10-2)6-4-7;;/h3-5H,1-2H3;1H;/q;;+1/p-1/rC8H9IO2Zn/c1-10-6-3-4-7(11-2)8(5-6)12-9/h3-5H,1-2H3
SMILES:COC1C=CC(=C=C1)OC.I.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.