CAS 738580-38-6

(3,4-dimethoxyphenyl)-iodo-zinc

Description:

(3,4-Dimethoxyphenyl)-iodo-zinc, identified by its CAS number 738580-38-6, is an organozinc compound that features a zinc atom coordinated to an iodo group and a 3,4-dimethoxyphenyl moiety. This compound typically exhibits characteristics common to organozinc reagents, such as high reactivity and the ability to participate in various organic transformations, including cross-coupling reactions. The presence of the dimethoxyphenyl group enhances its solubility in organic solvents and may influence its reactivity and selectivity in synthetic applications. Organometallic compounds like this one are often utilized in organic synthesis for the formation of carbon-carbon bonds, making them valuable in the development of pharmaceuticals and complex organic molecules. Additionally, the iodine atom can serve as a leaving group, facilitating nucleophilic substitution reactions. Overall, (3,4-dimethoxyphenyl)-iodo-zinc is a versatile reagent in the field of organic chemistry, particularly in the synthesis of aryl compounds.

Formula: C₈H₉IO₂Zn

InChI: InChI=1/C8H9O2.HI.Zn/c1-9-7-5-3-4-6-8(7)10-2;;/h3,5-6H,1-2H3;1H;/q;;+1/p-1/rC8H9IO2Zn/c1-10-7-4-3-6(12-9)5-8(7)11-2/h3-5H,1-2H3