CAS 738580-40-0
:bromo-(4-isoquinolyl)magnesium
Description:
Bromo-(4-isoquinolyl)magnesium, with the CAS number 738580-40-0, is an organomagnesium compound that belongs to the class of Grignard reagents. This compound features a bromo group attached to a 4-isoquinolyl moiety, which contributes to its reactivity and utility in organic synthesis. Grignard reagents are known for their ability to act as nucleophiles, allowing them to react with a variety of electrophiles, including carbonyl compounds, to form new carbon-carbon bonds. The presence of the isoquinoline structure can influence the reactivity and selectivity of the compound in synthetic applications. Typically, Grignard reagents are sensitive to moisture and air, requiring an anhydrous environment for storage and use. They are often utilized in the formation of complex organic molecules, making them valuable in pharmaceutical and materials chemistry. Safety precautions are essential when handling this compound due to its reactivity and potential hazards associated with organomagnesium compounds.
Formula:C9H6BrMgN
InChI:InChI=1/C9H6N.BrH.Mg/c1-2-4-9-7-10-6-5-8(9)3-1;;/h1-4,6-7H;1H;/q;;+1/p-1/rC9H6BrMgN/c10-11-9-6-12-5-7-3-1-2-4-8(7)9/h1-6H
SMILES:c1ccc2cnccc2c1.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.