CymitQuimica logo

CAS 738580-42-2

:

chloro-[(2,3-dimethoxyphenyl)methyl]magnesium

Description:
Chloro-[(2,3-dimethoxyphenyl)methyl]magnesium, with the CAS number 738580-42-2, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by their reactivity, particularly with electrophiles, due to the presence of a carbon-magnesium bond. This specific compound features a chloro group and a 2,3-dimethoxyphenylmethyl moiety, which contributes to its unique chemical properties. Grignard reagents are typically used in organic synthesis for the formation of carbon-carbon bonds, enabling the construction of complex molecules. The presence of the dimethoxyphenyl group may enhance the compound's stability and solubility in organic solvents. Additionally, the reactivity of this compound can be influenced by the electron-donating nature of the methoxy groups, which can affect its nucleophilicity. As with other Grignard reagents, it is sensitive to moisture and air, requiring an anhydrous environment for handling and storage. Overall, chloro-[(2,3-dimethoxyphenyl)methyl]magnesium is a valuable reagent in synthetic organic chemistry.
Formula:C9H11ClMgO2
InChI:InChI=1/C9H11O2.ClH.Mg/c1-7-5-4-6-8(10-2)9(7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11ClMgO2/c1-12-8-5-3-4-7(6-11-10)9(8)13-2/h3-5H,6H2,1-2H3
SMILES:C=C1C=CC=C(C1OC)OC.Cl.[Mg]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.