CAS 738580-60-4

chloro-[(2-ethoxyphenyl)methyl]magnesium

Description:

Chloro-[(2-ethoxyphenyl)methyl]magnesium, with the CAS number 738580-60-4, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a magnesium atom bonded to an organic group and a halogen, in this case, chlorine. This specific compound features a 2-ethoxyphenyl group, which contributes to its reactivity and solubility properties. Grignard reagents are known for their ability to act as nucleophiles, making them valuable in organic synthesis for forming carbon-carbon bonds. The presence of the ethoxy group enhances the compound's solubility in organic solvents, facilitating its use in various reactions. Additionally, the compound is sensitive to moisture and air, requiring careful handling under an inert atmosphere to prevent decomposition. Overall, chloro-[(2-ethoxyphenyl)methyl]magnesium is a useful reagent in synthetic organic chemistry, particularly in the formation of complex organic molecules.

Formula: C₉H₁₁ClMgO

InChI: InChI=1/C9H11O.ClH.Mg/c1-3-10-9-7-5-4-6-8(9)2;;/h4-7H,2-3H2,1H3;1H;/q;;+1/p-1/rC9H11ClMgO/c1-2-12-9-6-4-3-5-8(9)7-11-10/h3-6H,2,7H2,1H3

SMILES: CCOC1=CC=C[CH]C1=C.Cl.[Mg]