CAS 738580-61-5
:bromo-(3-quinolyl)magnesium
Description:
Bromo-(3-quinolyl)magnesium, with the CAS number 738580-61-5, is an organomagnesium compound that belongs to the class of Grignard reagents. This compound features a magnesium atom bonded to a bromo group and a 3-quinolyl moiety, which is derived from quinoline, a bicyclic aromatic compound. The presence of the bromine atom makes it a useful reagent in organic synthesis, particularly for nucleophilic addition reactions. Grignard reagents like bromo-(3-quinolyl)magnesium are highly reactive, especially with water and protic solvents, leading to the formation of hydrocarbons and magnesium hydroxides. They are typically handled under anhydrous conditions to prevent decomposition. The compound can be utilized in various synthetic applications, including the formation of carbon-carbon bonds and the synthesis of complex organic molecules. Its reactivity and ability to act as a nucleophile make it valuable in the field of organic chemistry, particularly in the development of pharmaceuticals and fine chemicals.
Formula:C9H6BrMgN
InChI:InChI=1/C9H6N.BrH.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-2,4-7H;1H;/q;;+1/p-1/rC9H6BrMgN/c10-11-8-5-7-3-1-2-4-9(7)12-6-8/h1-6H
SMILES:c1ccc2c(c1)C=C=CN2.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.