CAS 73863-47-5

2-Chloro-7-methyl-3-phenylquinoline

Description:

2-Chloro-7-methyl-3-phenylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the second position, a methyl group at the seventh position, and a phenyl group at the third position of the quinoline skeleton. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the chlorine atom can influence its reactivity and solubility, while the methyl and phenyl substituents can affect its biological activity and interaction with other molecules. Typically, compounds like this may exhibit fluorescence and can be used as intermediates in the synthesis of more complex organic molecules. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential toxicity or environmental impact.

Formula: C₁₆H₁₂ClN

InChI: InChI=1S/C16H12ClN/c1-11-7-8-13-10-14(12-5-3-2-4-6-12)16(17)18-15(13)9-11/h2-10H,1H3

InChI key: InChIKey=UXEPEEALYXYHAE-UHFFFAOYSA-N

SMILES: ClC=1C(=CC2=C(N1)C=C(C)C=C2)C3=CC=CC=C3

Synonyms:

• Quinoline, 2-chloro-7-methyl-3-phenyl-
• 2-Chloro-7-methyl-3-phenylquinoline