CAS 73866-15-6

3-(1H-benzimidazol-1-yl)propan-1-aminium

Description:

3-(1H-benzimidazol-1-yl)propan-1-aminium, with the CAS number 73866-15-6, is an organic compound characterized by its structure, which includes a benzimidazole moiety linked to a propan-1-aminium group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the benzimidazole ring suggests possible applications in pharmaceuticals, as benzimidazole derivatives are known for their diverse biological properties, including antifungal and anti-parasitic activities. The aminium group indicates that the compound is likely to be protonated under physiological conditions, which can influence its solubility and interaction with biological targets. Additionally, the compound may exhibit ionic characteristics due to the aminium group, affecting its behavior in solution and its potential as a drug candidate. Overall, 3-(1H-benzimidazol-1-yl)propan-1-aminium is of interest in medicinal chemistry and may serve as a lead compound for further development in therapeutic applications.

Formula: C₁₀H₁₃N₃

InChI: InChI=1/C10H13N3/c11-6-3-7-13-8-12-9-4-1-2-5-10(9)13/h1-2,4-5,8H,3,6-7,11H2

SMILES: c1ccc2c(c1)ncn2CCCN

Synonyms:

• 1H-benzimidazole-1-propanamine

3-(1H-Benzo[d]imidazol-1-yl)propan-1-amine

CAS: 73866-15-6

3-(1H-Benzo[d]imidazol-1-yl)propan-1-amine

Purity: 97%

Molecular weight: 175.23g/mol

Ref: 54-OR76734

3-(1H-Benzo[d]imidazol-1-yl)propan-1-amine

CAS: 73866-15-6

Purity: 97%

Molecular weight: 175.24

Ref: 10-F605506

[3-(1H-benzimidazol-1-yl)propyl]amine hydrochloride

CAS: 73866-15-6

Formula: C₁₀H₁₄ClN₃

Purity: 98%

Molecular weight: 211.69

Ref: 10-F373813