CAS 73866-19-0
:1H-Benzotriazole-1-propanamine
Description:
1H-Benzotriazole-1-propanamine, with the CAS number 73866-19-0, is an organic compound that features a benzotriazole moiety, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound typically exhibits characteristics such as being a colorless to light yellow solid or liquid, depending on its specific form and purity. It is known for its applications in various fields, including as a corrosion inhibitor, particularly in metalworking fluids and coatings, due to its ability to form stable complexes with metal ions. The presence of the propanamine group enhances its solubility in polar solvents, making it versatile in different chemical environments. Additionally, 1H-Benzotriazole derivatives are recognized for their UV-absorbing properties, which can be beneficial in protecting materials from photodegradation. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique structure and functional groups contribute to its utility in industrial applications.
Formula:C9H12N4
InChI:InChI=1S/C9H12N4/c10-6-3-7-13-9-5-2-1-4-8(9)11-12-13/h1-2,4-5H,3,6-7,10H2
InChI key:InChIKey=YTTOVIWXZJVEQO-UHFFFAOYSA-N
SMILES:C(CCN)N1C=2C(N=N1)=CC=CC2
Synonyms:- 1H-Benzotriazole-1-propanamine
- 3-Benzotriazol-1-ylpropylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.