CAS 7387-57-7
:2',3',5'-tri-O-acetyladenosine
Description:
2',3',5'-tri-O-acetyladenosine is a modified nucleoside derived from adenosine, characterized by the presence of three acetyl groups attached to the hydroxyl groups at the 2', 3', and 5' positions of the ribose sugar. This modification enhances the lipophilicity and stability of the molecule, making it useful in various biochemical applications. The compound retains the purine base adenine, which is crucial for its biological activity. It is often utilized in the synthesis of oligonucleotides and as a building block in nucleic acid research due to its ability to mimic natural nucleosides while providing improved solubility and cellular uptake. Additionally, 2',3',5'-tri-O-acetyladenosine can serve as a substrate for various enzymes, including kinases and polymerases, facilitating studies in enzymatic activity and nucleic acid interactions. Its CAS number, 7387-57-7, is a unique identifier that aids in the cataloging and retrieval of information regarding this compound in chemical databases.
Formula:C16H19N5O7
InChI:InChI=1/C16H19N5O7/c1-7(22)25-4-10-12(26-8(2)23)13(27-9(3)24)16(28-10)21-6-20-11-14(17)18-5-19-15(11)21/h5-6,10,12-13,16H,4H2,1-3H3,(H2,17,18,19)/t10-,12-,13-,16-/m1/s1
SMILES:CC(=O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)OC(=O)C)OC(=O)C
Synonyms:- Nsc 76766
- Adenosine, 2',3',5'-triacetate
- 2',3',5'-Tri-O-acetyl adenosine
- 2',3',5'-Tri-O-Acetyl-D-Adenosine
- 2',3',5'-TRI-O-ACETYLADENOSINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-amino-9H-purin-9-yl)tetrahydrofuran-3,4-diyl diacetate
CAS:Formula:C16H19N5O7Purity:97%Color and Shape:SolidMolecular weight:393.3514(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-Amino-9H-Purin-9-Yl)Tetrahydrofuran-3,4-Diyl Diacetate
CAS:(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(6-Amino-9H-Purin-9-Yl)Tetrahydrofuran-3,4-Diyl DiacetatePurity:98%Molecular weight:393.35g/mol2’,3’,5’-Tri-O-acetyl adenosine
CAS:<p>2',3',5'-Tri-O-acetyl adenosine is an adenosine analogue suitable for biochemical experiments and drug synthesis research.</p>Formula:C16H19N5O7Purity:99.9%Color and Shape:SolidMolecular weight:393.352',3',5'-Tri-O-acetyladenosine
CAS:<p>2',3',5'-Tri-O-acetyladenosine is a chemically protected form of adenosine with potential for use as an intermediate in nucleoside synthesis and nucleic acid chemistry. The hydroxyl (–OH) groups at the 2′, 3′, and 5′ positions of the ribose are protected by acetyl groups (–COCH₃), which can prevent unwanted chemical reactions during chemical synthesis.</p>Formula:C16H19N5O7Purity:Min. 95%Color and Shape:PowderMolecular weight:393.35 g/mol2′,3′,5′-Tri-O-acetyl
CAS:Formula:C16H19N5O7Purity:97%Color and Shape:Liquid, No data available.Molecular weight:393.3562’,3’,5’-Tri-O-acetyladenosine
CAS:<p>Applications 2’,3’,5’-Tri-O-acetyladenosine (cas# 7387-57-7) is a compound useful in organic synthesis.<br></p>Formula:C16H19N5O7Color and Shape:White To Off-WhiteMolecular weight:393.35






