CAS 73870-35-6
:Foresaconitine
Description:
Foresaconitine, with the CAS number 73870-35-6, is a chemical compound that belongs to the class of alkaloids, specifically derived from the Aconitum species, commonly known as monkshood or wolfsbane. This compound is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Foresaconitine is known for its potent pharmacological properties, particularly its analgesic and anti-inflammatory effects, making it of interest in medicinal chemistry. However, it is also associated with toxicity, as many aconitine derivatives can be highly toxic and potentially lethal if misused. The compound's mechanism of action often involves modulation of ion channels, particularly sodium channels, which can lead to significant physiological effects. Due to its toxic nature, handling foresaconitine requires caution, and its use is typically restricted to controlled environments within research settings. Overall, foresaconitine exemplifies the dual nature of many natural products, offering both therapeutic potential and significant risks.
Formula:C35H49NO9
InChI:InChI=1S/C35H49NO9/c1-8-36-17-33(18-39-3)14-13-25(42-6)35-23-15-22-24(41-5)16-34(45-19(2)37,27(31(35)36)29(43-7)30(33)35)26(23)28(22)44-32(38)20-9-11-21(40-4)12-10-20/h9-12,22-31H,8,13-18H2,1-7H3/t22-,23-,24+,25+,26-,27+,28+,29+,30-,31-,33+,34-,35+/m1/s1
InChI key:InChIKey=LYUPEIXJYAJCHL-YKLHRILBSA-N
SMILES:O(C)[C@@H]1[C@@]23[C@]4([C@](COC)(CN(CC)[C@@]2([C@]([C@@H]4OC)([C@]5(OC(C)=O)[C@@]6([C@]3(C[C@@]([C@@H]6OC(=O)C7=CC=C(OC)C=C7)([C@@H](OC)C5)[H])[H])[H])[H])[H])CC1)[H]
Synonyms:- (1alpha,6alpha,14alpha,16beta)-8-Acetoxy-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate
- 11aH-12,3,6a-Ethanylylidene-7,9-methanonaphth[2,3-b]azocine, aconitane-8,14-diol deriv.
- 3,13,15-Trideoxyjesaconitine
- Aconitane-8,14-diol, 20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-, 8-acetate 14-(4-methoxybenzoate), (1α,6α,14α,16β)-
- Benzoic Acid, 4-Methoxy-, (1Alpha,6Alpha,14Alpha,16Beta)-8-(Acetyloxy)-20-Ethyl-1,6,16-Trimethoxy-4-(Methoxymethyl)Aconitan-14-Yl Ester
- Chasmanine 8-acetate 14-(p-methoxybenzoate)
- Foresachaconitine
- Foresaconitine
- Forresaconitine
- Vilmorrianine C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Foresaconitine
CAS:Foresaconitine is a natural productFormula:C35H49NO9Purity:98%Color and Shape:SolidMolecular weight:627.775Foresaconitine
CAS:Foresaconitine is a highly active alkaloid compound derived from the Aconitum genus, commonly known as aconite. This compound is sourced from the roots of various Aconitum species, which have been utilized in traditional medicine but must be handled with caution due to their toxic nature. As an alkaloid, Foresaconitine predominantly affects the nervous system through its interaction with voltage-gated sodium channels. By prolonging the opening of these channels, it modifies neuronal excitability, leading to altered nerve transmission.Formula:C35H49NO9Purity:Min. 95%Molecular weight:627.76 g/mol


