CAS 73877-03-9

3-[(3-chloro-4-methylphenyl)amino]-3-oxopropanoic acid

Description:

3-[(3-chloro-4-methylphenyl)amino]-3-oxopropanoic acid, identified by its CAS number 73877-03-9, is an organic compound characterized by its structural features that include an amino group, a ketone, and a carboxylic acid functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid and amino groups, respectively. It is likely to be soluble in polar solvents, such as water, due to its ability to form hydrogen bonds. The presence of the chloro and methyl substituents on the aromatic ring can influence its reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. As a result, this compound may have applications in pharmaceuticals or as a biochemical probe. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species.

Formula: C₁₀H₁₀ClNO₃

InChI: InChI=1/C10H10ClNO3/c1-6-2-3-7(4-8(6)11)12-9(13)5-10(14)15/h2-4H,5H2,1H3,(H,12,13)(H,14,15)

SMILES: Cc1ccc(cc1Cl)N=C(CC(=O)O)O

Synonyms:

• Propanoic Acid, 3-[(3-Chloro-4-Methylphenyl)Amino]-3-Oxo-