CAS 7388-58-1
:N-methylhexadecanamide
Description:
N-methylhexadecanamide, also known as N-methylpalmitamide, is an amide derived from hexadecanoic acid (palmitic acid) and methylamine. It features a long hydrophobic hydrocarbon chain, which contributes to its lipophilic properties, making it soluble in organic solvents but less soluble in water. The molecular structure includes a methyl group attached to the nitrogen atom of the amide functional group, which influences its physical and chemical properties. N-methylhexadecanamide is typically a solid at room temperature and has a relatively high melting point due to the long carbon chain. It is used in various applications, including as a surfactant, emulsifier, or in the formulation of personal care products. Additionally, it may exhibit biological activity, potentially serving as a signaling molecule or influencing cellular processes. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H35NO
InChI:InChI=1/C17H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18-2/h3-16H2,1-2H3,(H,18,19)
SMILES:CCCCCCCCCCCCCCCC(=NC)O
Synonyms:- hexadecanamide, N-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
HexadecanaMide, N-Methyl-
CAS:Formula:C17H35NOPurity:95%Color and Shape:SolidMolecular weight:269.4659Palmitic Acid Methylamide
CAS:Controlled ProductApplications Palmitic Acid Methylamide is an intermediate in the synthesis of N-Methyl-N-nitroso-1-hexadecylamine (M325190). N-Methyl-N-nitroso-1-hexadecanamine is a compound found in a wide range of cosmetic products and cleaning emulsions.
References Kamp, E.. et al.: Food. Chem. Toxicol., 29, 203 (1991); Lalljie, S. P. D., et al.: Adv. Mass. Spec., 14, 33790 (1998); Abidi, S.L., et al.: J. Chroma., 324, 209 (1985)Formula:C17H35NOColor and Shape:NeatMolecular weight:269.47

