
CAS 73886-28-9
:Heptopargil
Description:
Heptopargil, identified by the CAS number 73886-28-9, is a chemical substance that belongs to a class of compounds known for their unique structural and functional properties. While specific details about Heptopargil may not be widely documented, substances with similar naming conventions often exhibit characteristics such as being organic compounds, potentially containing multiple functional groups that influence their reactivity and interactions. These compounds may be utilized in various applications, including pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. The molecular structure typically dictates the physical properties, such as solubility, boiling point, and stability under different conditions. Additionally, safety data sheets and regulatory information would provide insights into handling, toxicity, and environmental impact. For precise applications and characteristics, consulting specialized chemical databases or literature is recommended, as they can provide detailed information on synthesis, reactivity, and potential uses in various fields.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-5-8-15-14-11-9-10-6-7-13(11,4)12(10,2)3/h1,10H,6-9H2,2-4H3
InChI key:InChIKey=RYOCQKYEVIJALB-UHFFFAOYSA-N
SMILES:CC12C(=NOCC#C)CC(C1(C)C)CC2
Synonyms:- Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, O-2-propynyloxime, (±)-
- Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, O-2-propynyloxime
- Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, O-2-propyn-1-yloxime
- EGYT 2250
- Heptopargil
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Heptopargil
CAS:Heptopargil is a growth regulator.Formula:C13H19NOColor and Shape:SolidMolecular weight:205.3
