CymitQuimica logo

CAS 73895-38-2

:

N6-(1-Methylethyl)-3-nitro-2,6-pyridinediamine

Description:
N6-(1-Methylethyl)-3-nitro-2,6-pyridinediamine, with the CAS number 73895-38-2, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with both an isopropyl group and a nitro group, which contributes to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity and can influence its biological activity. Pyridine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific arrangement of functional groups in this compound may impart certain characteristics such as solubility in organic solvents, potential for hydrogen bonding, and varied reactivity under different conditions. Additionally, the compound's structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its properties, including its stability, toxicity, and potential applications.
Formula:C8H12N4O2
InChI:InChI=1S/C8H12N4O2/c1-5(2)10-7-4-3-6(12(13)14)8(9)11-7/h3-5H,1-2H3,(H3,9,10,11)
InChI key:InChIKey=KIEFXUSPHDNXKF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)N=C(NC(C)C)C=C1
Synonyms:
  • N6-(1-Methylethyl)-3-nitro-2,6-pyridinediamine
  • 2,6-Pyridinediamine, N6-(1-methylethyl)-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.