CAS 73895-98-4

6-Bromo-4-methylpyridin-2-amine

Description:

6-Bromo-4-methylpyridin-2-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position and a methyl group at the 4-position of the pyridine ring contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar organic solvents. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The amino group at the 2-position enhances its reactivity, allowing for various chemical modifications. Additionally, the compound may exhibit properties such as being a weak base due to the nitrogen atom in the ring, which can participate in hydrogen bonding. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 6-Bromo-4-methylpyridin-2-amine serves as a valuable building block in organic synthesis and drug discovery.

Formula: C₆H₇BrN₂

InChI: InChI=1/C6H7BrN2/c1-4-2-5(7)9-6(8)3-4/h2-3H,1H3,(H2,8,9)

SMILES: Cc1cc(Br)nc(c1)N

Synonyms:

• 2-Bromo-4-methyl-6-aminopyridine
• 2-Pyridinamine, 6-Bromo-4-Methyl-
• 6-Brom-4-methyl-2-pyridinamin
• 6-Bromo-4-methyl-2-pyridinamine
• 2-Amino-6-bromo-4-picoline

6-Bromo-4-methylpyridin-2-amine

CAS: 73895-98-4

Formula: C₆H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.0372

Ref: IN-DA0038GA

2-Amino-6-bromo-4-methylpyridine

CAS: 73895-98-4

2-Amino-6-bromo-4-methylpyridine

Formula: C₆H₇BrN₂

Purity: ≥95%

Color and Shape: white to off white solid

Molecular weight: 187.04g/mol

Ref: 54-OR46205

6-Bromo-4-methylpyridin-2-amine

CAS: 73895-98-4

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.04

Ref: 10-F093618