CymitQuimica logo

CAS 73898-21-2

:

1-(4-Cyclohexyl-3-hydroxyphenyl)ethanone

Description:
1-(4-Cyclohexyl-3-hydroxyphenyl)ethanone, with the CAS number 73898-21-2, is an organic compound characterized by its ketone functional group and a phenolic structure. This compound features a cyclohexyl group attached to a phenolic ring, which contributes to its unique chemical properties. The presence of the hydroxyl (-OH) group on the phenyl ring enhances its solubility in polar solvents and can influence its reactivity, particularly in hydrogen bonding and potential antioxidant activity. The ethanone moiety indicates that it is a ketone, which typically exhibits reactivity in nucleophilic addition reactions. This compound may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals or as a precursor for more complex chemical structures. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage.
Formula:C14H18O2
InChI:InChI=1S/C14H18O2/c1-10(15)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h7-9,11,16H,2-6H2,1H3
InChI key:InChIKey=YBGYHUNTWRTDQQ-UHFFFAOYSA-N
SMILES:OC1=C(C=CC(C(C)=O)=C1)C2CCCCC2
Synonyms:
  • 1-(4-Cyclohexyl-3-hydroxyphenyl)ethan-1-one
  • 1-(4-Cyclohexyl-3-hydroxyphenyl)ethanone
  • Ethanone, 1-(4-cyclohexyl-3-hydroxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.