CymitQuimica logo

CAS 7390-67-2

:

2-(1H-indol-3-yl)-N-(4-methoxybenzyl)ethanamine

Description:
2-(1H-indol-3-yl)-N-(4-methoxybenzyl)ethanamine, with the CAS number 7390-67-2, is a chemical compound that features an indole moiety, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by its amine functional group, which contributes to its potential biological activity. The presence of the methoxy group on the benzyl portion enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The indole structure is often associated with various pharmacological properties, including effects on serotonin receptors, making this compound of interest in medicinal chemistry. Its molecular structure suggests it may exhibit properties relevant to neuropharmacology or as a potential therapeutic agent. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups, which are critical for its application in research and development. Overall, this compound represents a unique combination of structural features that may contribute to its biological significance.
Formula:C18H20N2O
InChI:InChI=1/C18H20N2O/c1-21-16-8-6-14(7-9-16)12-19-11-10-15-13-20-18-5-3-2-4-17(15)18/h2-9,13,19-20H,10-12H2,1H3
SMILES:COc1ccc(cc1)CNCCc1c[nH]c2ccccc12
Synonyms:
  • 1H-indole-3-ethanamine, N-[(4-methoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.