CymitQuimica logo

CAS 73901-14-1

:

(2Z)-6-ethoxy-3-methyl-1,3-benzothiazol-2(3H)-imine

Description:
(2Z)-6-ethoxy-3-methyl-1,3-benzothiazol-2(3H)-imine is a chemical compound characterized by its unique structural features, which include a benzothiazole core, an ethoxy group, and a methyl substituent. The presence of the imine functional group indicates a double bond between nitrogen and carbon, contributing to its reactivity and potential applications in organic synthesis. This compound typically exhibits properties such as moderate solubility in organic solvents, and its molecular structure may influence its optical and electronic characteristics. The benzothiazole moiety is known for its biological activity, making derivatives of this compound of interest in medicinal chemistry. Additionally, the ethoxy group can enhance lipophilicity, potentially affecting the compound's interaction with biological systems. Overall, (2Z)-6-ethoxy-3-methyl-1,3-benzothiazol-2(3H)-imine represents a versatile scaffold for further chemical modifications and investigations into its properties and applications in various fields, including pharmaceuticals and materials science.
Formula:C10H12N2OS
InChI:InChI=1/C10H12N2OS/c1-3-13-7-4-5-8-9(6-7)14-10(11)12(8)2/h4-6,11H,3H2,1-2H3/b11-10-
SMILES:CCOc1ccc2c(c1)sc(=N)n2C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.