CAS 73903-17-0

(6-Chloro-1H-benzimidazol-2-yl)(4-methyl-1-piperazinyl)methanone

Description:

(6-Chloro-1H-benzimidazol-2-yl)(4-methyl-1-piperazinyl)methanone, with the CAS number 73903-17-0, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety and a piperazine ring. The presence of a chlorine atom at the 6-position of the benzimidazole enhances its biological activity and solubility properties. This compound typically exhibits properties such as moderate to high solubility in polar solvents, which is common for many benzimidazole derivatives. It may also display significant pharmacological activities, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The piperazine group contributes to its potential as a ligand in receptor interactions, influencing its efficacy and selectivity. Overall, this compound's unique structural features and functional groups suggest potential applications in drug development and therapeutic interventions, although specific biological activities would require empirical investigation.

Formula: C₁₃H₁₅ClN₄O

InChI: InChI=1S/C13H15ClN4O/c1-17-4-6-18(7-5-17)13(19)12-15-10-3-2-9(14)8-11(10)16-12/h2-3,8H,4-7H2,1H3,(H,15,16)

InChI key: InChIKey=MOIWSUQWIOVGRH-UHFFFAOYSA-N

SMILES: C(=O)(C=1NC=2C(N1)=CC=C(Cl)C2)N3CCN(C)CC3

Synonyms:

• Piperazine, 1-[(5-chloro-1H-benzimidazol-2-yl)carbonyl]-4-methyl-
• JNJ 10191584
• (5-Chloro-1H-benzimidazol-2-yl)(4-methylpiperazin-1-yl)methanone
• (6-Chloro-1H-benzimidazol-2-yl)(4-methyl-1-piperazinyl)methanone
• Methanone, (6-chloro-1H-benzimidazol-2-yl)(4-methyl-1-piperazinyl)-

(5-Chloro-1H-benzo[d]imidazol-2-yl)(4-methylpiperazin-1-yl)methanone

CAS: 73903-17-0

(5-Chloro-1H-benzo[d]imidazol-2-yl)(4-methylpiperazin-1-yl)methanone

Purity: 98%

Molecular weight: 278.74g/mol

Ref: 54-OR1074666

JNJ 10191584

CAS: 73903-17-0

JNJ 10191584 is a chemical compound that functions as a selective adrenergic receptor antagonist, developed through synthetic organic chemistry processes. This compound primarily affects the adrenergic system by blocking specific adrenergic receptors in the central nervous system. Its mode of action involves the inhibition of receptor activity, which modulates neurotransmitter release and influences various physiological responses.

Formula: C₁₃H₁₅ClN₄O

Purity: Min. 95%

Molecular weight: 278.74 g/mol

Ref: 3D-YCA90317

JNJ-10191584

CAS: 73903-17-0

JNJ-10191584, a potent and selective antagonist at the histamine H4 receptor, has antiinflammatory and analgesic effects in animal studies of acute inflammation

Formula: C₁₃H₁₅ClN₄O

Color and Shape: Solid

Molecular weight: 278.74

Ref: TM-T27658