
CAS 73907-94-5
:1,6-Dihydropyrrolo[2,3-g]indazole-7,8-dione
Description:
1,6-Dihydropyrrolo[2,3-g]indazole-7,8-dione, with the CAS number 73907-94-5, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both pyrrole and indazole moieties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. Its structure features two fused rings, which contribute to its stability and reactivity. The presence of carbonyl groups in the dione functional groups enhances its potential for hydrogen bonding and reactivity in various chemical reactions. Additionally, the compound may exhibit fluorescence properties, which can be useful in biological imaging applications. Its solubility and stability in different solvents can vary, influencing its application in various fields, including pharmaceuticals and materials science. Overall, 1,6-Dihydropyrrolo[2,3-g]indazole-7,8-dione represents a significant compound for further research due to its intriguing structural features and potential therapeutic applications.
Formula:C9H5N3O2
InChI:InChI=1S/C9H5N3O2/c13-8-6-5(11-9(8)14)2-1-4-3-10-12-7(4)6/h1-3H,(H,10,12)(H,11,13,14)
InChI key:InChIKey=WRCYJWHCGDSZMU-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=CC2NC1=O)C=NN3
Synonyms:- NSC 350008
- 1,6-Dihydropyrrolo[2,3-g]indazole-7,8-dione
- Pyrrolo[2,3-g]indazole-7,8-dione, 1,6-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
