
CAS 73907-99-0
:Ethyl 6-amino-1H-indazole-7-carboxylate
Description:
Ethyl 6-amino-1H-indazole-7-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an amino group at the 6-position and an ethyl ester at the 7-position contributes to its reactivity and solubility properties. This compound typically appears as a solid and is soluble in organic solvents, making it useful in various chemical reactions and applications. It may exhibit biological activity, which is of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The carboxylate group can participate in various chemical transformations, such as esterification and amidation, while the amino group can engage in hydrogen bonding and nucleophilic reactions. Overall, Ethyl 6-amino-1H-indazole-7-carboxylate is a versatile compound with potential applications in drug discovery and organic synthesis.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-2-15-10(14)8-7(11)4-3-6-5-12-13-9(6)8/h3-5H,2,11H2,1H3,(H,12,13)
InChI key:InChIKey=SCTMZLMUCSXNGV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2C(=CC=C1N)C=NN2
Synonyms:- Ethyl 6-amino-1H-indazole-7-carboxylate
- 1H-Indazole-7-carboxylic acid, 6-amino-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
