CAS 73909-05-4
:1,1-dioxido-2,3-dihydrothiophen-3-yl thiocyanate
Description:
1,1-Dioxido-2,3-dihydrothiophen-3-yl thiocyanate, identified by its CAS number 73909-05-4, is a chemical compound that features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound is characterized by the presence of a dioxido group, indicating the incorporation of two oxygen atoms in the form of oxo groups, which can influence its reactivity and stability. The thiocyanate group (-SCN) attached to the thiophene ring contributes to its potential applications in various fields, including organic synthesis and materials science. The presence of both sulfur and nitrogen in the thiocyanate moiety can impart unique chemical properties, such as coordination capabilities with metal ions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as solubility and melting point, would depend on the specific molecular interactions and the overall structure, which can be influenced by the substituents on the thiophene ring.
Formula:C5H5NO2S2
InChI:InChI=1/C5H5NO2S2/c6-4-9-5-1-2-10(7,8)3-5/h1-2,5H,3H2
SMILES:C1=CS(=O)(=O)CC1SC#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.