CAS 7391-29-9
:2-methyl-3-oxo-3-phenylpropanenitrile
Description:
2-Methyl-3-oxo-3-phenylpropanenitrile, with the CAS number 7391-29-9, is an organic compound characterized by its functional groups, including a ketone and a nitrile. This compound features a phenyl group attached to a central carbon that also bears a methyl group and a cyano group (nitrile). The presence of the ketone functional group contributes to its reactivity, making it a potential intermediate in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound is soluble in organic solvents, which is common for many nitriles and ketones. Its chemical properties allow it to participate in various reactions, such as nucleophilic additions and condensation reactions. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2-methyl-3-oxo-3-phenylpropanenitrile is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C10H9NO
InChI:InChI=1/C10H9NO/c1-8(7-11)10(12)9-5-3-2-4-6-9/h2-6,8H,1H3
SMILES:CC(C#N)C(=O)c1ccccc1
Synonyms:- Benzenepropanenitrile, Alpha-Methyl-Beta-Oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Methyl-3-oxo-3-phenylpropanenitrile
CAS:2-Methyl-3-oxo-3-phenylpropanenitrile is an activated form of acetonitrile. It is a colorless liquid with a strong ammonia odor. 2-Methyl-3-oxo-3-phenylpropanenitrile is used as a reagent in organic synthesis and can be used to catalyze the elimination of hydroxyl groups, activating groups, and carbonyl groups. 2-Methyl-3-oxo-3-phenylpropanenitrile has been shown to be capable of hydrogenating unsaturated bonds during the course of nucleophilic substitution reactions. The compound can also be used to synthesize isoxazoles, which are used as pharmaceuticals or pesticides.Formula:C10H9NOPurity:Min. 95%Molecular weight:159.18 g/mol
