CymitQuimica logo

CAS 7391-45-9

:

Cycloheptanecarbonitrile, 2-oxo-

Description:
Cycloheptanecarbonitrile, 2-oxo- (CAS 7391-45-9) is an organic compound characterized by its cyclic structure and functional groups. It features a seven-membered cycloheptane ring with a carbonitrile (-C≡N) group and a ketone (2-oxo) functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. Cycloheptanecarbonitrile, 2-oxo- may exhibit reactivity typical of carbonyl and nitrile groups, allowing it to participate in nucleophilic addition reactions and other transformations. Its structural characteristics contribute to its potential utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c9-6-7-4-2-1-3-5-8(7)10/h7H,1-5H2
InChI key:InChIKey=BRYGFWGUISGAND-UHFFFAOYSA-N
SMILES:C(#N)C1C(=O)CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.