CAS 7391-60-8
:1,3-Diphenyl-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
1,3-Diphenyl-2,4,6(1H,3H,5H)-pyrimidinetrione, also known by its CAS number 7391-60-8, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two phenyl groups and three carbonyl (keto) groups. This compound typically exhibits a crystalline solid form and is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the keto groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and cyclization. Additionally, the phenyl substituents can influence the compound's solubility and stability, making it of interest in the development of new materials or drugs. Its unique structure may also impart specific optical or electronic properties, which can be explored for applications in organic electronics or photonics. Overall, 1,3-Diphenyl-2,4,6(1H,3H,5H)-pyrimidinetrione is a versatile compound with significant potential in both research and industrial applications.
Formula:C16H12N2O3
InChI:InChI=1/C16H12N2O3/c19-14-11-15(20)18(13-9-5-2-6-10-13)16(21)17(14)12-7-3-1-4-8-12/h1-10H,11H2
InChI key:InChIKey=FBQJKKPQBMSWEP-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)CC(=O)N1C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1,3-Diphenyl-1,3-diazinane-2,4,6-trione
- 1,3-Diphenyl-2,4,6(1H,3H,5H)-pyrimidinetrione
- 1,3-Diphenyl-pyrimidine-2,4,6-trione
- 1,3-Diphenylbarbituric acid
- 1,3-Diphenylpyrimidine-2,4,6-trione
- 2,4,6(1H,3H,5H)-pyrimidinetrione, 1,3-diphenyl-
- Barbituric acid, 1,3-diphenyl-
- Diphenylbarbituric acid
- N,N′-Diphenylbarbituric acid
- 1,3-Diphenylpyrimidine-2,4,6(1H,3H,5H)-trione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Diphenylpyrimidine-2,4,6(1H,3H,5H)-trione
CAS:Controlled ProductFormula:C16H12N2O3Color and Shape:NeatMolecular weight:280.278
