CAS 73919-92-3

2-Bromo-4-(chloromethyl)thiophene

Description:

2-Bromo-4-(chloromethyl)thiophene is a heterocyclic organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic ring containing sulfur. This compound features both bromine and chloromethyl substituents, which contribute to its reactivity and potential applications in organic synthesis. The bromine atom is typically a good leaving group, making the compound useful in nucleophilic substitution reactions. The chloromethyl group can also participate in various chemical transformations, enhancing its versatility in synthetic chemistry. This compound is often utilized in the development of pharmaceuticals, agrochemicals, and materials science due to its unique electronic properties and the ability to undergo further functionalization. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as both bromine and chlorine are hazardous substances. Overall, 2-Bromo-4-(chloromethyl)thiophene serves as an important building block in the synthesis of more complex organic molecules.

Formula: C₅H₄BrClS

InChI: InChI=1S/C5H4BrClS/c6-5-1-4(2-7)3-8-5/h1,3H,2H2

InChI key: InChIKey=CDFSPUOWARZVSY-UHFFFAOYSA-N

SMILES: C(Cl)C=1C=C(Br)SC1

Synonyms:

• Thiophene, 2-bromo-4-(chloromethyl)-
• 2-Bromo-4-(chloromethyl)thiophene