
CAS 73919-94-5
:4-(Bromomethyl)-2-chlorothiophene
Description:
4-(Bromomethyl)-2-chlorothiophene is a heterocyclic organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic ring containing sulfur. This compound features a bromomethyl group and a chlorine substituent, which contribute to its reactivity and potential applications in organic synthesis. The bromomethyl group can serve as a versatile electrophile in various chemical reactions, such as nucleophilic substitutions, while the chlorine atom can influence the electronic properties of the thiophene ring. The presence of these halogen substituents can enhance the compound's utility in the development of pharmaceuticals, agrochemicals, and materials science. Additionally, the compound's structure may impart specific physical properties, such as solubility and melting point, which are important for its practical applications. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are essential when handling and using 4-(Bromomethyl)-2-chlorothiophene in laboratory and industrial settings.
Formula:C5H4BrClS
InChI:InChI=1S/C5H4BrClS/c6-2-4-1-5(7)8-3-4/h1,3H,2H2
InChI key:InChIKey=GWBBXEKGOVAHEM-UHFFFAOYSA-N
SMILES:C(Br)C=1C=C(Cl)SC1
Synonyms:- Thiophene, 4-(bromomethyl)-2-chloro-
- 4-(Bromomethyl)-2-chlorothiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.