CAS 739315-22-1
:4-amino-2-chloro-N-ethylbenzamide
Description:
4-Amino-2-chloro-N-ethylbenzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of an amino group (-NH2) and a chloro group (-Cl) on the benzene ring contributes to its reactivity and potential applications in various chemical processes. The ethyl group attached to the nitrogen atom enhances its lipophilicity, which may influence its solubility and biological activity. This compound typically appears as a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The specific interactions and properties of 4-amino-2-chloro-N-ethylbenzamide can be influenced by factors such as pH, temperature, and the presence of other chemical species. As with many amides, it may participate in hydrogen bonding, affecting its physical properties and reactivity. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H11ClN2O
InChI:InChI=1/C9H11ClN2O/c1-2-12-9(13)7-4-3-6(11)5-8(7)10/h3-5H,2,11H2,1H3,(H,12,13)
SMILES:CCN=C(c1ccc(cc1Cl)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
